883546-51-8 Usage
Uses
Used in Pharmaceutical Industry:
5-PROPYL-THIOPHENE-3-CARBOXYLIC ACID is used as a key intermediate in the synthesis of pharmaceuticals for its potential anti-inflammatory and antioxidant properties. It aids in the development of new drugs that can address various health conditions by leveraging its chemical reactivity and structural attributes.
Used in Agrochemical Industry:
In the agrochemical sector, 5-PROPYL-THIOPHENE-3-CARBOXYLIC ACID is utilized as a building block in the creation of new agrochemical compounds. Its unique structure allows for the development of innovative products that can enhance crop protection and contribute to sustainable agricultural practices.
Used in Organic Electronic Materials:
5-PROPYL-THIOPHENE-3-CARBOXYLIC ACID is employed as a component in the synthesis of organic electronic materials. Its properties make it suitable for use in the development of organic semiconductors, which are crucial in the fabrication of electronic devices such as organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs).
Used in Chemical and Materials Science Research:
5-PROPYL-THIOPHENE-3-CARBOXYLIC ACID serves as a valuable building block in the field of chemical and materials science research. Its unique structure and properties are harnessed for the development of new compounds and materials with potential applications in various industries, including pharmaceuticals, agrochemicals, and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 883546-51-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,3,5,4 and 6 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 883546-51:
(8*8)+(7*8)+(6*3)+(5*5)+(4*4)+(3*6)+(2*5)+(1*1)=208
208 % 10 = 8
So 883546-51-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H10O2S/c1-2-3-7-4-6(5-11-7)8(9)10/h4-5H,2-3H2,1H3,(H,9,10)
