884494-73-9 Usage
Uses
Used in Pharmaceutical Industry:
3-Fluoro-5-formyl-2-methoxypyridine is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs with potential therapeutic applications. Its unique structure allows for the creation of molecules with specific properties that can address various medical needs.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Fluoro-5-formyl-2-methoxypyridine serves as an essential intermediate in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these products can enhance their effectiveness in protecting crops and managing pests, thereby contributing to increased agricultural productivity.
Used in Research and Development:
3-Fluoro-5-formyl-2-methoxypyridine is utilized in research and development settings as a compound of interest for exploring its chemical properties and potential applications. Scientists and researchers use it to investigate new reactions, syntheses, and mechanisms, which can lead to advancements in chemical knowledge and the discovery of novel applications.
It is crucial to handle 3-Fluoro-5-formyl-2-methoxypyridine with care, adhering to proper safety guidelines to mitigate any hazards associated with its use. This ensures the safe and effective application of this versatile chemical compound in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 884494-73-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 4 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 884494-73:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*4)+(2*7)+(1*3)=229
229 % 10 = 9
So 884494-73-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H6FNO2/c1-11-7-6(8)2-5(4-10)3-9-7/h2-4H,1H3
884494-73-9Relevant articles and documents
HETEROARYL SUBSTITUTED HETEROCYCLYL SULFONES
-
Page/Page column 85, (2015/11/09)
The invention relates to aryl substituted heterocyclyl sulfones as voltage gated calcium channel blockers, to pharmaceutical compositions containing these compounds and also to these compounds for use in the treatment and/or prophylaxis of pain and further diseases and/or disorders.
NOVEL HETEROCYCLIC COMPOUND OR SALT THEREOF AND INTERMEDIATE THEREOF
-
, (2009/03/07)
Disclosed is a compound represented by the general formula: [wherein R1 represents an aryl or heterocyclic group which may be substituted or the like; X1 represents a C2-C4 alkylene group or the like; X2, X3 and X5 independently represent NH, a bond or the like; X4 represents a lower alkylene group, a bond or the like; Y1 represents a bivalent alicyclic hydrocarbon residue which may be substituted or a bivalent alicyclic amine residue which may be substituted; and Z1, Z2, Z3, Z4, Z5 and Z6 independently represent a nitrogen atom, a group represented by the formula: CH, or the like, provided that at least one of Z3, Z4, Z5 and Z6 represents a nitrogen atom] or a salt thereof, which is useful as an antibacterial agent.
