885277-64-5 Usage
Uses
Used in Pharmaceutical Industry:
(3-AMINO-PYRROLIDIN-1-YL)-ACETIC ACID is used as an intermediate in the synthesis of various pharmaceuticals for its ability to form stable complexes with metal ions, enhancing the efficacy and stability of the final drug products.
Used in Agrochemical Industry:
In the agrochemical sector, (3-AMINO-PYRROLIDIN-1-YL)-ACETIC ACID serves as an intermediate in the production of agrochemicals, contributing to the development of effective and stable products for agricultural applications.
Used in Materials Science:
(3-AMINO-PYRROLIDIN-1-YL)-ACETIC ACID is utilized as a chelating agent in the production of metal-based catalysts, playing a crucial role in enhancing the catalytic activity and selectivity of these catalysts in various chemical reactions.
Used in Chemical Sensors Development:
(3-AMINO-PYRROLIDIN-1-YL)-ACETIC ACID's chelating properties also make it a valuable component in the development of chemical sensors, where its ability to bind metal ions can be exploited for the detection and measurement of specific metal concentrations in various environments.
Check Digit Verification of cas no
The CAS Registry Mumber 885277-64-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,7 and 7 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 885277-64:
(8*8)+(7*8)+(6*5)+(5*2)+(4*7)+(3*7)+(2*6)+(1*4)=225
225 % 10 = 5
So 885277-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2O2/c7-5-1-2-8(3-5)4-6(9)10/h5H,1-4,7H2,(H,9,10)
