885949-15-5 Usage
Uses
Used in Pharmaceutical Industry:
(R)-PIPERIDINE-3-CARBOXYLIC ACID HCL is used as a key intermediate in the synthesis of various medications, contributing to the development of new therapeutic agents. Its presence in the production process aids in the creation of pharmaceutical compounds with specific chiral properties, which are essential for their efficacy and safety.
Used in Agrochemical Industry:
In the agrochemical sector, (R)-PIPERIDINE-3-CARBOXYLIC ACID HCL is employed as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its role in these applications is vital for enhancing crop protection and ensuring agricultural productivity.
Used as a Chiral Auxiliary in Organic Synthesis:
(R)-PIPERIDINE-3-CARBOXYLIC ACID HCL is utilized as a chiral auxiliary in organic synthesis, playing a crucial role in the formation of enantiomerically pure compounds. This application is significant in the production of optically active molecules, which are essential in various chemical and pharmaceutical processes.
Used in Drug Development:
(R)-PIPERIDINE-3-CARBOXYLIC ACID HCL is involved in the development of new drugs, where its potential pharmacological activity is harnessed to create innovative therapeutic agents. Its contribution to drug discovery is valuable in advancing the field of medicinal chemistry and improving patient care.
Check Digit Verification of cas no
The CAS Registry Mumber 885949-15-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,9,4 and 9 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 885949-15:
(8*8)+(7*8)+(6*5)+(5*9)+(4*4)+(3*9)+(2*1)+(1*5)=245
245 % 10 = 5
So 885949-15-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2.ClH/c8-6(9)5-2-1-3-7-4-5;/h5,7H,1-4H2,(H,8,9);1H/t5-;/m1./s1
