886363-42-4 Usage
Uses
Used in Pharmaceutical Development:
1-(3-THIOPHEN-3-YL-BENZOYL)-PIPERIDIN-4-ONE is utilized as a key component in the development of pharmaceuticals due to its unique chemical structure and potential medicinal properties. Its incorporation into drug formulations can contribute to the creation of novel therapeutic agents.
Used in Organic Synthesis:
In the field of organic chemistry, 1-(3-THIOPHEN-3-YL-BENZOYL)-PIPERIDIN-4-ONE is employed as a building block for the synthesis of other complex organic compounds. Its versatile structure allows for further chemical modifications, facilitating the development of new molecules with specific functions and applications.
Used in Medicinal Chemistry Research:
1-(3-THIOPHEN-3-YL-BENZOYL)-PIPERIDIN-4-ONE is used as a subject of study in medicinal chemistry research to explore its potential interactions with biological targets and its efficacy in treating various diseases. This research can lead to a better understanding of the compound's properties and its role in drug discovery processes.
Check Digit Verification of cas no
The CAS Registry Mumber 886363-42-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 3 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 886363-42:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*3)+(2*4)+(1*2)=214
214 % 10 = 4
So 886363-42-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H15NO2S/c18-15-4-7-17(8-5-15)16(19)13-3-1-2-12(10-13)14-6-9-20-11-14/h1-3,6,9-11H,4-5,7-8H2
