886498-56-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Methoxy-4-fluorobenzyl cyanide is used as a synthetic intermediate for the development of pharmaceuticals, leveraging its unique molecular structure to contribute to the creation of new drugs with specific therapeutic properties. Its presence in the synthesis process allows for the exploration of novel chemical entities that can address unmet medical needs.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Methoxy-4-fluorobenzyl cyanide is utilized as a precursor in the production of various agrochemicals. Its role in this industry is pivotal for the synthesis of compounds that can enhance crop protection and contribute to sustainable agricultural practices.
Used in Organic Chemistry Research:
2-Methoxy-4-fluorobenzyl cyanide is also employed as a research compound in organic chemistry. It serves as a building block for the synthesis of complex organic molecules, facilitating the discovery of new chemical reactions and the development of innovative synthetic routes.
Used in Fine Chemicals Production:
2-Methoxy-4-fluorobenzyl cyanide is used as a key intermediate in the production of fine chemicals, which are high-purity specialty chemicals used in various applications such as fragrances, dyes, and other high-value products. Its unique properties make it suitable for the synthesis of these high-quality chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 886498-56-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,4,9 and 8 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 886498-56:
(8*8)+(7*8)+(6*6)+(5*4)+(4*9)+(3*8)+(2*5)+(1*6)=252
252 % 10 = 2
So 886498-56-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H8FNO/c1-12-9-6-8(10)3-2-7(9)4-5-11/h2-3,6H,4H2,1H3
