887592-51-0 Usage
Uses
Used in Organic Synthesis:
(3-METHYL-3H-IMDAZOL-4-YLMETHYL)-HYDRAZINE is used as a key intermediate in organic synthesis for the creation of complex organic molecules. Its unique structure allows for versatile chemical reactions, facilitating the development of new compounds with specific properties.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (3-METHYL-3H-IMDAZOL-4-YLMETHYL)-HYDRAZINE is utilized as a precursor in the development of new drugs. Its chemical properties contribute to the design of pharmaceuticals with targeted therapeutic effects, potentially leading to innovative treatments for various diseases.
Used in Agrochemical Development:
(3-METHYL-3H-IMDAZOL-4-YLMETHYL)-HYDRAZINE also finds application in the agrochemical sector, where it serves as a building block for the synthesis of bioactive compounds used in crop protection and pest control. Its role in creating effective and environmentally friendly agrochemicals is of significant importance.
Used in Material Science:
(3-METHYL-3H-IMDAZOL-4-YLMETHYL)-HYDRAZINE's unique structure and properties make it a candidate for applications in material science, where it could be used to develop new materials with specific characteristics for use in various industries, including electronics, textiles, and coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 887592-51-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,5,9 and 2 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 887592-51:
(8*8)+(7*8)+(6*7)+(5*5)+(4*9)+(3*2)+(2*5)+(1*1)=240
240 % 10 = 0
So 887592-51-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N4/c1-9-4-7-2-5(9)3-8-6/h2,4,8H,3,6H2,1H3
