887596-65-8 Usage
Uses
Used in Organic Synthesis:
[4-(DIFLUOROMETHOXY)BENZYL]HYDRAZINE HYDROCHLORIDE is used as a key intermediate in the synthesis of complex organic molecules, particularly those with pharmaceutical or agrochemical applications. Its unique structure allows for further functionalization and modification, making it a versatile component in the development of novel compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, [4-(DIFLUOROMETHOXY)BENZYL]HYDRAZINE HYDROCHLORIDE is employed as a building block for the design and synthesis of new drugs. Its incorporation into drug candidates can potentially enhance their pharmacological properties, such as potency, selectivity, and bioavailability.
Used in Agrochemical Production:
[4-(DIFLUOROMETHOXY)BENZYL]HYDRAZINE HYDROCHLORIDE also finds application in the agrochemical sector, where it is used as a starting material for the development of new pesticides, herbicides, and other crop protection agents. Its unique chemical structure can contribute to the creation of more effective and environmentally friendly agrochemicals.
Used as a Reagent in Drug Development:
In addition to its role as a building block, [4-(DIFLUOROMETHOXY)BENZYL]HYDRAZINE HYDROCHLORIDE is also utilized as a reagent in the development of new drugs. Its reactivity and functional group compatibility make it a valuable tool in the synthesis of drug candidates, potentially leading to the discovery of novel therapeutic agents with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 887596-65-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,5,9 and 6 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 887596-65:
(8*8)+(7*8)+(6*7)+(5*5)+(4*9)+(3*6)+(2*6)+(1*5)=258
258 % 10 = 8
So 887596-65-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H10F2N2O.ClH/c9-8(10)13-7-3-1-6(2-4-7)5-12-11;/h1-4,8,12H,5,11H2;1H
