889949-65-9 Usage
Molecular weight
195.26 g/mol This is the mass of one mole of the compound.
Used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds This describes the common use of the compound in the production of other chemicals.
Building block in the production of various organic chemicals and materials This describes the importance of the compound in the production of other chemicals and materials.
Includes a benzyl group, an amino group, and an ethoxy group This describes the specific functional groups that are present in the chemical structure of the compound, which makes it versatile and important in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 889949-65-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,9,9,4 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 889949-65:
(8*8)+(7*8)+(6*9)+(5*9)+(4*4)+(3*9)+(2*6)+(1*5)=279
279 % 10 = 9
So 889949-65-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO2/c1-2-14-11-5-3-4-10(8-11)9-12-6-7-13/h3-5,8,12-13H,2,6-7,9H2,1H3
