89585-14-8 Usage
Uses
Used in Organic Synthesis:
(2-ethoxybutyl)amine(SALTDATA: 1.05HCl) is used as a reagent in organic synthesis for its ability to participate in various chemical reactions, such as the formation of amide bonds, which are crucial in the synthesis of pharmaceuticals and other organic compounds.
Used in Industrial Processes:
In the chemical industry, (2-ethoxybutyl)amine(SALTDATA: 1.05HCl) is used as an intermediate in the production of various chemical products, including surfactants, detergents, and other specialty chemicals, due to its unique structure and reactivity.
It is important to handle and store (2-ethoxybutyl)amine(SALTDATA: 1.05HCl) with the appropriate precautions due to its potential hazards and reactivity, ensuring safety in its applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 89585-14-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,5,8 and 5 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 89585-14:
(7*8)+(6*9)+(5*5)+(4*8)+(3*5)+(2*1)+(1*4)=188
188 % 10 = 8
So 89585-14-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H15NO/c1-3-6(5-7)8-4-2/h6H,3-5,7H2,1-2H3
