898289-37-7 Usage
Uses
Used in Organic Synthesis:
2-(Tetrahydropyran-4-yloxy)benzonitrile is used as a building block in organic synthesis for the production of various organic compounds. Its unique structure allows for the creation of a wide range of molecules with diverse properties and applications.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-(Tetrahydropyran-4-yloxy)benzonitrile is utilized as a key intermediate in the development of new pharmaceuticals. Its presence in the molecular structure can contribute to the desired pharmacological properties of the final drug product.
Used in Agrochemical Production:
2-(Tetrahydropyran-4-yloxy)benzonitrile is employed as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its ability to form nitrogen-containing compounds makes it a valuable component in the development of effective and environmentally friendly agrochemicals.
Used as a Precursor for Nitrogen-Containing Compounds:
The nitrile group in 2-(Tetrahydropyran-4-yloxy)benzonitrile makes it a potential precursor for the synthesis of various nitrogen-containing compounds. These compounds can be used in different industries, including the production of specialty chemicals, materials, and other applications where nitrogen-containing compounds are required.
Check Digit Verification of cas no
The CAS Registry Mumber 898289-37-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,2,8 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 898289-37:
(8*8)+(7*9)+(6*8)+(5*2)+(4*8)+(3*9)+(2*3)+(1*7)=257
257 % 10 = 7
So 898289-37-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO2/c13-9-10-3-1-2-4-12(10)15-11-5-7-14-8-6-11/h1-4,11H,5-8H2
