898791-93-0 Usage
Uses
Used in Pharmaceutical Industry:
CYCLOPENTYL 2,4-DIFLUOROPHENYL KETONE is utilized as a building block for the synthesis of a range of biologically active compounds. Its unique structure allows it to be a key component in the development of new pharmaceuticals, contributing to the creation of innovative treatments and therapies.
Used in Organic Synthesis:
In the realm of organic synthesis, CYCLOPENTYL 2,4-DIFLUOROPHENYL KETONE serves as a reagent for the preparation of complex organic molecules. Its ability to participate in various chemical reactions makes it a valuable tool for the synthesis of intricate organic compounds, facilitating advancements in organic chemistry.
Used in Materials Science:
CYCLOPENTYL 2,4-DIFLUOROPHENYL KETONE also has potential applications in the field of materials science. Its unique properties may contribute to the development of new functional materials with specific characteristics, such as improved stability, reactivity, or selectivity, which can be harnessed in various industrial applications.
Used in the Development of New Functional Materials:
CYCLOPENTYL 2,4-DIFLUOROPHENYL KETONE's potential in the development of new functional materials is attributed to its structural features and reactivity. CYCLOPENTYL 2,4-DIFLUOROPHENYL KETONE can be integrated into the design and synthesis of materials with tailored properties for specialized uses, such as in sensors, catalysts, or advanced materials for energy storage and conversion.
Check Digit Verification of cas no
The CAS Registry Mumber 898791-93-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,9 and 1 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 898791-93:
(8*8)+(7*9)+(6*8)+(5*7)+(4*9)+(3*1)+(2*9)+(1*3)=270
270 % 10 = 0
So 898791-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H12F2O/c13-9-5-6-10(11(14)7-9)12(15)8-3-1-2-4-8/h5-8H,1-4H2
