903551-32-6 Usage
Uses
Used in Pharmaceutical Industry:
4-Chloro-5-fluoroindoline is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of drugs with specific therapeutic properties. Its unique structure allows for the creation of molecules with targeted biological activities.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Chloro-5-fluoroindoline serves as an intermediate in the production of compounds that can be used in pest control and crop protection, leveraging its chemical properties to enhance the effectiveness of these products.
Used in Materials Science:
4-Chloro-5-fluoroindoline is utilized in materials science for its potential to contribute to the development of new materials with specific properties, such as improved stability or reactivity, which can be beneficial in various industrial applications.
Used in Organic Synthesis:
As a versatile building block in organic synthesis, 4-Chloro-5-fluoroindoline is used to construct a wide range of chemical compounds, demonstrating its utility in creating molecules with diverse applications across different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 903551-32-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,3,5,5 and 1 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 903551-32:
(8*9)+(7*0)+(6*3)+(5*5)+(4*5)+(3*1)+(2*3)+(1*2)=146
146 % 10 = 6
So 903551-32-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClFN/c9-8-5-3-4-11-7(5)2-1-6(8)10/h1-2,11H,3-4H2