912761-41-2 Usage
Uses
Used in Pharmaceutical Industry:
N-CYCLOPROPYL-2-(PIPERIDIN-4-YLOXY)ACETAMIDE is used as a building block for the synthesis of various drugs due to its unique chemical structure and properties. Its cyclopropyl and piperidin-4-yloxy groups provide a foundation for the development of new pharmaceutical compounds with potential therapeutic benefits.
Used in Drug Discovery and Development:
N-CYCLOPROPYL-2-(PIPERIDIN-4-YLOXY)ACETAMIDE is used as a starting material in drug discovery and development processes. Its potential pharmaceutical properties, such as being a potential analgesic and anesthetic, make it a promising candidate for further research and development into new medications.
Used in Medicinal Chemistry Research:
N-CYCLOPROPYL-2-(PIPERIDIN-4-YLOXY)ACETAMIDE is utilized in medicinal chemistry research to explore its potential as a therapeutic agent. Its chemical structure allows for modifications and optimizations to enhance its pharmaceutical properties and effectiveness in treating specific conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 912761-41-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,2,7,6 and 1 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 912761-41:
(8*9)+(7*1)+(6*2)+(5*7)+(4*6)+(3*1)+(2*4)+(1*1)=162
162 % 10 = 2
So 912761-41-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H18N2O2/c13-10(12-8-1-2-8)7-14-9-3-5-11-6-4-9/h8-9,11H,1-7H2,(H,12,13)
