914349-42-1 Usage
Uses
Used in Pharmaceutical Industry:
5-M-TOLYLPYRIMIDIN-2-YLAMINE is used as a building block for the synthesis of various biologically active compounds, contributing to the development of new pharmaceuticals. Its unique structure allows for the creation of molecules with potential therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 5-M-TOLYLPYRIMIDIN-2-YLAMINE serves as an intermediate in the synthesis of active ingredients for pesticides and other crop protection products. Its incorporation aids in the development of effective and targeted agrochemicals.
Used in Chemical Synthesis:
5-M-TOLYLPYRIMIDIN-2-YLAMINE is utilized as a valuable intermediate in various chemical synthesis processes. Its versatile structure allows for the formation of a wide range of compounds, expanding the scope of chemical research and product development.
Check Digit Verification of cas no
The CAS Registry Mumber 914349-42-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,4,3,4 and 9 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 914349-42:
(8*9)+(7*1)+(6*4)+(5*3)+(4*4)+(3*9)+(2*4)+(1*2)=171
171 % 10 = 1
So 914349-42-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N3/c1-8-3-2-4-9(5-8)10-6-13-11(12)14-7-10/h2-7H,1H3,(H2,12,13,14)