91464-97-0 Usage
Uses
Used in Explosive Manufacturing:
H 261 is used as a key ingredient in the production of explosives due to its high reactivity and ability to enhance the explosive properties of the final product.
Used in Ceramics Industry:
In the ceramics industry, H 261 is used as a glaze component to achieve specific color and texture effects in the final ceramic products. Its chemical properties contribute to the desired characteristics of the glaze.
Used in Dye Manufacturing:
H 261 is used as a dye component in the production of various types of dyes, particularly those requiring a deep or intense color. Its chemical properties allow for the creation of vibrant and long-lasting dyes.
It is crucial to note that due to the high toxicity of H 261, strict safety precautions must be taken during its handling and use to prevent harm to both humans and the environment. This includes proper storage, handling, and disposal methods to minimize the risk of exposure and contamination.
Check Digit Verification of cas no
The CAS Registry Mumber 91464-97-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,4,6 and 4 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 91464-97:
(7*9)+(6*1)+(5*4)+(4*6)+(3*4)+(2*9)+(1*7)=150
150 % 10 = 0
So 91464-97-0 is a valid CAS Registry Number.
InChI:InChI=1/C50H73N13O9/c1-7-30(6)43(48(69)61-40(50(71)72)20-34-24-54-27-57-34)62-44(65)35(29(4)5)21-42(64)37(16-28(2)3)58-46(67)39(19-33-23-53-26-56-33)59-45(66)38(17-31-12-9-8-10-13-31)60-47(68)41-14-11-15-63(41)49(70)36(51)18-32-22-52-25-55-32/h8-10,12-13,22-30,35-43,64H,7,11,14-21,51H2,1-6H3,(H,52,55)(H,53,56)(H,54,57)(H,58,67)(H,59,66)(H,60,68)(H,61,69)(H,62,65)(H,71,72)/t30-,35-,36-,37-,38-,39-,40-,41-,42-,43+/m0/s1