919347-69-6 Usage
Uses
Used in Organic Synthesis:
(5-Formylpyridin-3-yl)boronic acid is used as a reagent in the Suzuki–Miyaura coupling reaction, a widely employed method for forming carbon-carbon bonds. This reaction is crucial for the synthesis of complex organic molecules, including those with potential pharmaceutical and agrochemical applications.
Used in Pharmaceutical Development:
In the pharmaceutical industry, (5-Formylpyridin-3-yl)boronic acid is used as a key intermediate in the synthesis of various drug candidates. Its unique structure allows for the creation of new compounds with specific biological activities, contributing to the discovery of novel therapeutic agents.
Used in Agrochemical Development:
Similarly, in agrochemical research, (5-Formylpyridin-3-yl)boronic acid serves as an important building block for the development of new pesticides and other crop protection agents. Its ability to form stable carbon-carbon bonds facilitates the synthesis of molecules with enhanced efficacy and selectivity.
Used in Material Science:
(5-Formylpyridin-3-yl)boronic acid is also utilized in the field of material science for the synthesis of new materials with unique properties. Its incorporation into polymers and other materials can lead to the development of advanced materials with applications in various industries, such as electronics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 919347-69-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,9,3,4 and 7 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 919347-69:
(8*9)+(7*1)+(6*9)+(5*3)+(4*4)+(3*7)+(2*6)+(1*9)=206
206 % 10 = 6
So 919347-69-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BNO3/c9-4-5-1-6(7(10)11)3-8-2-5/h1-4,10-11H
