926238-85-9 Usage
Uses
Given the limited information on the specific applications of 1-(3-METHYLBUTANOYL)PIPERIDINE-4-CARBOXYLIC ACID, the following potential uses are hypothesized based on its chemical structure and properties:
Used in Pharmaceutical Industry:
1-(3-METHYLBUTANOYL)PIPERIDINE-4-CARBOXYLIC ACID could be utilized as an active pharmaceutical ingredient (API) for the development of new drugs. Its unique structure may offer specific binding affinities or interactions with biological targets, potentially leading to the discovery of novel therapeutic agents.
Used in Chemical Industry:
In the chemical industry, 1-(3-METHYLBUTANOYL)PIPERIDINE-4-CARBOXYLIC ACID might serve as an intermediate in the synthesis of more complex organic compounds. Its functional groups could be further modified or used as a building block in the creation of specialty chemicals or materials with tailored properties.
Check Digit Verification of cas no
The CAS Registry Mumber 926238-85-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,6,2,3 and 8 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 926238-85:
(8*9)+(7*2)+(6*6)+(5*2)+(4*3)+(3*8)+(2*8)+(1*5)=189
189 % 10 = 9
So 926238-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H19NO3/c1-8(2)7-10(13)12-5-3-9(4-6-12)11(14)15/h8-9H,3-7H2,1-2H3,(H,14,15)
