931409-74-4 Usage
Uses
Used in Pharmaceutical Industry:
(S)-3-Benzyloxy-pyrrolidine Hydrochloride is used as a synthetic auxiliary for the production of various pharmaceutical compounds. Its unique structure and properties facilitate the synthesis of complex molecules, enhancing the efficiency and effectiveness of drug development processes.
Used in Laboratory Research:
In laboratory settings, (S)-3-Benzyloxy-pyrrolidine Hydrochloride is employed as a research tool for studying the synthesis and properties of N-benzylpyrrolidine compounds. Its stability and solubility make it an ideal candidate for various experimental procedures and analyses.
Used in Chemical Synthesis:
(S)-3-Benzyloxy-pyrrolidine Hydrochloride is used as a reagent in the synthesis of other organic compounds, particularly those containing a pyrrolidine ring with a benzyl group. Its presence can influence the properties and reactivity of the resulting compounds, expanding the scope of chemical synthesis.
Used in Analytical Chemistry:
As a stable and soluble compound, (S)-3-Benzyloxy-pyrrolidine Hydrochloride can be utilized in analytical chemistry for the detection, quantification, and characterization of related compounds. Its distinct properties may serve as a reference or standard in various analytical techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 931409-74-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,1,4,0 and 9 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 931409-74:
(8*9)+(7*3)+(6*1)+(5*4)+(4*0)+(3*9)+(2*7)+(1*4)=164
164 % 10 = 4
So 931409-74-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO.ClH/c1-2-4-10(5-3-1)9-13-11-6-7-12-8-11;/h1-5,11-12H,6-9H2;1H/t11-;/m0./s1
931409-74-4Relevant articles and documents
CARBOXAMIDE DERIVATIVES AS MUSCARINIC RECEPTOR ANTAGONISTS
-
Page/Page column 43, (2008/06/13)
The invention relates to compounds of Formula (I) processes and intermediates for their preparation, their use as muscarinic antagonists and pharmaceutical composition containing them.
