933052-52-9 Usage
Uses
Used in Organic Synthesis:
2-(Morpholino)phenylboronic acid is used as a reagent in organic chemical reactions for its ability to form stable complexes with diols and other Lewis bases, facilitating various synthetic transformations.
Used in Pharmaceutical Industry:
2-(Morpholino)phenylboronic acid is used as a building block in drug discovery due to its potential to interact with biological targets and modulate their activity, contributing to the development of new therapeutic agents.
Used in Catalysis:
2-(Morpholino)phenylboronic acid is employed as a catalyst or catalyst precursor in various chemical reactions, leveraging its ability to form stable complexes with Lewis bases to enhance reaction efficiency and selectivity.
Used in Fluorescence Sensors:
2-(Morpholino)phenylboronic acid is used as a component in the development of fluorescence sensors, capitalizing on its ability to form complexes with specific analytes, leading to changes in fluorescence properties for sensing applications.
Used in Bioconjugation:
2-(Morpholino)phenylboronic acid is utilized in the field of bioconjugation to attach biologically relevant molecules, such as peptides, proteins, or nucleic acids, to various surfaces or other molecules, enabling the creation of novel biofunctional materials and tools.
Used in Medical Research:
2-(Morpholino)phenylboronic acid has been investigated for its potential role in treating conditions such as diabetes and cancer, due to its ability to modulate biological processes and interact with specific targets, offering new avenues for therapeutic intervention.
Check Digit Verification of cas no
The CAS Registry Mumber 933052-52-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,3,0,5 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 933052-52:
(8*9)+(7*3)+(6*3)+(5*0)+(4*5)+(3*2)+(2*5)+(1*2)=149
149 % 10 = 9
So 933052-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO3/c13-11(14)9-3-1-2-4-10(9)12-5-7-15-8-6-12/h1-4,13-14H,5-8H2
