941672-66-8 Usage
Uses
Used in Pharmaceutical Industry:
4-HYDROXY-1-PIPERIDIN-4-YL-PYRROLIDIN-2-ONE is used as a key intermediate in the synthesis of various pharmaceuticals, particularly those targeting the central nervous system. Its unique structure allows for the development of drugs with specific therapeutic effects, making it a valuable component in medicinal chemistry.
Used in Organic Chemistry:
In the field of organic chemistry, 4-HYDROXY-1-PIPERIDIN-4-YL-PYRROLIDIN-2-ONE is utilized as a versatile building block for the creation of biologically active compounds. Its reactivity and structural attributes facilitate the production of a diverse range of molecules with distinct functions and properties, contributing to the advancement of organic synthesis and compound development.
Check Digit Verification of cas no
The CAS Registry Mumber 941672-66-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,1,6,7 and 2 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 941672-66:
(8*9)+(7*4)+(6*1)+(5*6)+(4*7)+(3*2)+(2*6)+(1*6)=188
188 % 10 = 8
So 941672-66-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H16N2O2/c12-8-5-9(13)11(6-8)7-1-3-10-4-2-7/h7-8,10,12H,1-6H2
