947533-23-5 Usage
Uses
Used in Pharmaceutical Industry:
4-Cyanomethoxyphenylboronic acid is used as a building block for the synthesis of various pharmaceuticals. Its ability to form stable complexes with electron-rich species makes it a valuable component in the development of new drugs with improved efficacy and safety profiles.
Used in Agrochemical Industry:
In the agrochemical industry, 4-Cyanomethoxyphenylboronic acid is used as a key intermediate in the synthesis of agrochemicals. Its versatility in forming stable complexes allows for the creation of novel compounds with enhanced pesticidal properties, contributing to more effective crop protection.
Used in Organic Synthesis:
4-Cyanomethoxyphenylboronic acid is used as a reagent in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura. Its ability to form stable complexes with diols and other electron-rich species facilitates the formation of new carbon-carbon and carbon-heteroatom bonds, enabling the synthesis of complex organic molecules with potential applications in various fields.
Used in Chemical Research and Development:
4-Cyanomethoxyphenylboronic acid is utilized as a valuable tool in chemical research and development. Its unique properties and versatile applications make it an essential component in the exploration of new chemical reactions, the synthesis of novel compounds, and the development of innovative materials with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 947533-23-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,7,5,3 and 3 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 947533-23:
(8*9)+(7*4)+(6*7)+(5*5)+(4*3)+(3*3)+(2*2)+(1*3)=195
195 % 10 = 5
So 947533-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BNO3/c10-5-6-13-8-3-1-7(2-4-8)9(11)12/h1-4,11-12H,6H2
