954227-93-1 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Hydrazinyl-6-methoxypyrazine is used as an intermediate in the synthesis of pharmaceuticals and organic materials. Its unique chemical structure allows it to be a versatile building block for the development of new drugs and compounds with potential therapeutic applications.
Used in Organic Material Synthesis:
2-Hydrazinyl-6-methoxypyrazine is used as a precursor in the synthesis of various organic materials. Its chemical properties make it suitable for the creation of new materials with specific characteristics, such as improved stability or reactivity.
Used in Biological Activity Research:
2-Hydrazinyl-6-methoxypyrazine has been studied for its potential biological activity, including its antiproliferative and antifungal properties. This research could lead to the development of new treatments for various diseases and conditions, as well as new methods for controlling fungal growth in various settings.
Used in Food and Beverage Industry:
2-Hydrazinyl-6-methoxypyrazine has been identified as a volatile constituent in certain foods and beverages, contributing to their aroma and flavor profile. Its presence in these products could enhance the sensory experience for consumers, making it a valuable component in the development of new food and beverage products.
Check Digit Verification of cas no
The CAS Registry Mumber 954227-93-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,4,2,2 and 7 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 954227-93:
(8*9)+(7*5)+(6*4)+(5*2)+(4*2)+(3*7)+(2*9)+(1*3)=191
191 % 10 = 1
So 954227-93-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H8N4O/c1-10-5-3-7-2-4(8-5)9-6/h2-3H,6H2,1H3,(H,8,9)
