98947-00-3 Usage
Uses
Used in Pharmaceutical Industry:
(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)acetic acid is used as an intermediate in the synthesis of pharmaceuticals for its potential applications in the development of new drugs. Its structural features and reactivity make it a promising candidate for creating novel therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical industry, (7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)acetic acid is utilized as an intermediate in the synthesis of various agrochemicals, contributing to the development of new products for agricultural applications.
Used in Academic Research:
(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)acetic acid is also employed in academic research, where it may be used to study its chemical properties, reactivity, and potential applications in various fields, including medicinal chemistry and materials science.
Used in Chemical Synthesis Processes:
This versatile chemical compound is used in chemical synthesis processes to create a range of products, taking advantage of its unique structural features and reactivity to produce new compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 98947-00-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,9,4 and 7 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 98947-00:
(7*9)+(6*8)+(5*9)+(4*4)+(3*7)+(2*0)+(1*0)=193
193 % 10 = 3
So 98947-00-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrO4/c11-7-5-9-8(14-1-2-15-9)3-6(7)4-10(12)13/h3,5H,1-2,4H2,(H,12,13)/p-1
