10535-52-1 Usage
General Description
Tetrahydropyran-2-yl)methyl methacrylate is a chemical compound commonly used in the production of polymers and resins. It is derived from methacrylic acid and tetrahydropyran, and is classified as a methacrylate ester. (tetrahydropyran-2-yl)methyl methacrylate is known for its high reactivity and ability to form strong and durable bonds with other materials. It is often used in the production of adhesives, coatings, and sealants due to its fast curing time and high resistance to heat and chemicals. Additionally, the presence of the tetrahydropyran group in the molecule enhances the compound's flexibility and resistance to water, making it suitable for applications in harsh environmental conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 10535-52-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,3 and 5 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 10535-52:
(7*1)+(6*0)+(5*5)+(4*3)+(3*5)+(2*5)+(1*2)=71
71 % 10 = 1
So 10535-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H16O3/c1-8(2)10(11)13-7-9-5-3-4-6-12-9/h9H,1,3-7H2,2H3
