118553-99-4 Usage
Uses
Used in Pharmaceutical Industry:
H-Orn(2-Cl-Z)-OH is used as a reactant in peptide synthesis for the development of new pharmaceutical compounds. Its unique structure allows for the creation of diverse peptide sequences with potential therapeutic applications.
Used in Chemical Research:
As a chemical with distinct properties, H-Orn(2-Cl-Z)-OH can be utilized in research and development for understanding the behavior of similar compounds and their interactions with other molecules. This can lead to advancements in various chemical and material science applications.
Used in Biochemical Applications:
Due to its potential for peptide synthesis, H-Orn(2-Cl-Z)-OH may also find use in the field of biochemistry, where it could be employed in the design and synthesis of bioactive peptides for various biological studies and potential therapeutic uses.
Check Digit Verification of cas no
The CAS Registry Mumber 118553-99-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,5,5 and 3 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 118553-99:
(8*1)+(7*1)+(6*8)+(5*5)+(4*5)+(3*3)+(2*9)+(1*9)=144
144 % 10 = 4
So 118553-99-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H17ClN2O4/c14-10-5-2-1-4-9(10)8-20-13(19)16-7-3-6-11(15)12(17)18/h1-2,4-5,11H,3,6-8,15H2,(H,16,19)(H,17,18)/t11-/m0/s1