14178-45-1 Usage
General Description
2-CYANO-5-CARBOXAMIDOPYRIDINE, also known as 5-Cyanopicolinamide, is a chemical compound with the molecular formula C7H5N3O. It is a derivative of pyridine and contains a cyano and carboxamide group. 2-CYANO-5-CARBOXAMIDOPYRIDINE is commonly used in organic synthesis and pharmaceutical research as a building block for the production of various drugs. Its structural properties and functional groups make it a valuable intermediate in the synthesis of various compounds with potential pharmacological applications. Additionally, the chemical has been studied for its potential as an inhibitor of various enzymes and has shown promising results in medicinal chemistry research. Overall, 2-CYANO-5-CARBOXAMIDOPYRIDINE is a versatile and important chemical compound with potential applications in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 14178-45-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,1,7 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 14178-45:
(7*1)+(6*4)+(5*1)+(4*7)+(3*8)+(2*4)+(1*5)=101
101 % 10 = 1
So 14178-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O/c8-3-6-2-1-5(4-10-6)7(9)11/h1-2,4H,(H2,9,11)
