166943-39-1 Usage
Uses
Used in Pharmaceutical Industry:
N-Methyl-4-nitrophenethylamine hydrochloride is used as a reactant for the preparation of small molecule CDC25 phosphatase inhibitors. These inhibitors are important in the development of drugs targeting the regulation of protein phosphorylation, which plays a crucial role in various cellular processes, including cell cycle progression and signal transduction. By inhibiting CDC25 phosphatases, these small molecules can potentially be used to treat a range of diseases, including cancer, by disrupting the normal cell cycle and preventing uncontrolled cell growth.
Check Digit Verification of cas no
The CAS Registry Mumber 166943-39-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,6,9,4 and 3 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 166943-39:
(8*1)+(7*6)+(6*6)+(5*9)+(4*4)+(3*3)+(2*3)+(1*9)=171
171 % 10 = 1
So 166943-39-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2.ClH/c1-10-7-6-8-2-4-9(5-3-8)11(12)13;/h2-5,10H,6-7H2,1H3;1H