16947-89-0 Usage
Uses
Used in Pharmaceutical Industry:
ALPHA-BOC-GAMMA-Z-(DL)-DIAMINOBUTYRIC ACID is used as a building block for the synthesis of complex peptide structures. Its presence of a protecting group and a zwitterionic group allows for controlled reactivity and unique properties, which are essential in the development of therapeutic drugs.
Used in Biotechnological Industry:
ALPHA-BOC-GAMMA-Z-(DL)-DIAMINOBUTYRIC ACID is used as a key component in the creation of biotechnological products. Its role in peptide synthesis contributes to the advancement of innovative treatments and therapies in the biotech field.
Check Digit Verification of cas no
The CAS Registry Mumber 16947-89-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,9,4 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16947-89:
(7*1)+(6*6)+(5*9)+(4*4)+(3*7)+(2*8)+(1*9)=150
150 % 10 = 0
So 16947-89-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H23N.C10H18N2O6.C8H10/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-10(2,3)18-9(17)12-6(7(13)14)4-5-11-8(15)16;1-2-8-6-4-3-5-7-8/h11-13H,1-10H2;6,11H,4-5H2,1-3H3,(H,12,17)(H,13,14)(H,15,16);3-7H,2H2,1H3/t;6-;/m.0./s1