18339-94-1 Usage
General Description
1,1-Dimethylsila-11-crown-4, also known as DMS-11-crown-4, is a chemical compound with the molecular formula C14H28O4Si. It belongs to a class of compounds known as crown ethers, which are macrocyclic polyethers that contain multiple oxygen atoms. DMS-11-crown-4 is notable for its silicon atom, which gives it unique properties compared to its carbon-based counterparts. It is commonly used as a ligand for metal ions in organic synthesis and as a phase-transfer catalyst in organic reactions. Additionally, it has applications in various fields such as ion exchange, extraction, and separation processes. Its ability to selectively bind certain metal ions makes it useful in analytical chemistry and environmental remediation.
Check Digit Verification of cas no
The CAS Registry Mumber 18339-94-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,3,3 and 9 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 18339-94:
(7*1)+(6*8)+(5*3)+(4*3)+(3*9)+(2*9)+(1*4)=131
131 % 10 = 1
So 18339-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H18O4Si/c1-13(2)11-7-5-9-3-4-10-6-8-12-13/h3-8H2,1-2H3
