205528-30-9 Usage
Uses
Used in Proteomics Studies:
Fmoc-3-(4-pyridyl)-D-alanine is used as a building block for the synthesis of peptides and proteins in proteomics research. Its incorporation into peptide sequences allows for the study of protein structure, function, and interactions, contributing to a better understanding of biological processes and the development of new therapeutic strategies.
Used in Solid Phase Peptide Synthesis (SPPS):
Fmoc-3-(4-pyridyl)-D-alanine is used as a key component in solid phase peptide synthesis techniques. This method involves the stepwise addition of amino acid residues to a growing peptide chain, which is attached to an insoluble resin support. The Fmoc protection group ensures the selective addition of amino acids, allowing for the efficient and controlled synthesis of peptides with desired sequences.
Used in Pharmaceutical Industry:
Fmoc-3-(4-pyridyl)-D-alanine is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and properties make it a valuable building block for the development of new drugs, particularly those targeting specific biological receptors or enzymes.
Used in Chemical Research and Development:
Fmoc-3-(4-pyridyl)-D-alanine is used as a research tool in the development of new chemical methodologies and techniques. Its unique properties and reactivity can be exploited to explore novel synthetic routes, catalysis, and other areas of chemical science.
Check Digit Verification of cas no
The CAS Registry Mumber 205528-30-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,5,5,2 and 8 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 205528-30:
(8*2)+(7*0)+(6*5)+(5*5)+(4*2)+(3*8)+(2*3)+(1*0)=109
109 % 10 = 9
So 205528-30-9 is a valid CAS Registry Number.
InChI:InChI=1/C23H20N2O4/c26-22(27)21(13-15-9-11-24-12-10-15)25-23(28)29-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20-21H,13-14H2,(H,25,28)(H,26,27)/t21-/m1/s1