207226-02-6 Usage
Uses
Used in Pharmaceutical Industry:
3-Ethynylbenzenamine hydrochloride is used as an intermediate in the synthesis of various pharmaceuticals, particularly for the development of antiviral and anticancer drugs. Its unique structure allows for the creation of complex organic molecules that can target specific biological pathways, offering potential therapeutic benefits in treating viral infections and cancer.
Used in Organic Synthesis:
In the realm of organic synthesis, 3-Ethynylbenzenamine hydrochloride is utilized as a building block for constructing more intricate organic molecules. Its ethynyl group provides a versatile point for further chemical reactions, enabling the synthesis of a wide array of compounds with diverse applications in various industries.
Used in Chemical Industry:
3-Ethynylbenzenamine hydrochloride's improved solubility and stability make it a valuable compound for various applications within the chemical industry. Its properties allow for its use in the production of specialty chemicals, fine chemicals, and other advanced materials that require specific structural features for their intended purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 207226-02-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,2,2 and 6 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 207226-02:
(8*2)+(7*0)+(6*7)+(5*2)+(4*2)+(3*6)+(2*0)+(1*2)=96
96 % 10 = 6
So 207226-02-6 is a valid CAS Registry Number.
InChI:InChI=1S/C8H7N.ClH/c1-2-7-4-3-5-8(9)6-7;/h1,3-6H,9H2;1H
