20845-16-3 Usage
Uses
Used in Pharmaceutical Industry:
H-Glu(Oall)-Oall p-Tosylate is used as a protecting group in peptide synthesis for the carboxyl group of glutamic acid. It allows for selective deprotection and further modification of the peptide chain, which is crucial for the development of new pharmaceutical compounds with specific therapeutic properties.
Used in Chemical Synthesis:
H-Glu(Oall)-Oall p-Tosylate is used as a key component in the controlled assembly of peptides. Its p-tosylate group serves as a leaving group during peptide bond formation, enabling the synthesis of complex peptide structures with precise control over the sequence and functionality of the resulting molecules.
Used in Research and Development:
H-Glu(Oall)-Oall p-Tosylate is utilized in research and development for the study of peptide synthesis methods and the exploration of new applications for peptides in various fields, such as medicine, biotechnology, and materials science. Its role in facilitating selective deprotection and peptide chain modification contributes to the advancement of peptide-based research.
Check Digit Verification of cas no
The CAS Registry Mumber 20845-16-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,8,4 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20845-16:
(7*2)+(6*0)+(5*8)+(4*4)+(3*5)+(2*1)+(1*6)=93
93 % 10 = 3
So 20845-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO4.C7H8O3S/c1-3-7-15-10(13)6-5-9(12)11(14)16-8-4-2;1-6-2-4-7(5-3-6)11(8,9)10/h3-4,9H,1-2,5-8,12H2;2-5H,1H3,(H,8,9,10)/t9-;/m0./s1