21528-24-5 Usage
Description
2-[p-(Dimethylamino)benzoyl]-5-(dimethylamino)benzoic acid is a complex organic chemical compound that features benzoyl and benzoic acid derivatives with dimethylamino groups at specific positions. 2-[p-(Dimethylamino)benzoyl]-5-(dimethylamino)benzoic acid is known for its utility in organic synthesis and pharmaceutical research, and it holds promise for potential applications in medical treatments.
Uses
Used in Organic Synthesis:
2-[p-(Dimethylamino)benzoyl]-5-(dimethylamino)benzoic acid is used as a key intermediate in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for versatile reactions and the formation of a wide range of chemical products.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-[p-(Dimethylamino)benzoyl]-5-(dimethylamino)benzoic acid is utilized as a research compound to explore its potential in treating different medical conditions. Its specific chemical properties make it a candidate for drug development, particularly in the areas of medicinal chemistry and drug discovery.
Used in Medical Treatments:
Although the specific applications are not detailed in the provided materials, the compound's potential use in medical treatments suggests that it may be under investigation for its therapeutic effects on certain diseases or conditions. Its precise structure and properties could contribute to the development of new medications or therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 21528-24-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,5,2 and 8 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 21528-24:
(7*2)+(6*1)+(5*5)+(4*2)+(3*8)+(2*2)+(1*4)=85
85 % 10 = 5
So 21528-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2O3/c1-19(2)13-7-5-12(6-8-13)17(21)15-10-9-14(20(3)4)11-16(15)18(22)23/h5-11H,1-4H3,(H,22,23)
21528-24-5Relevant articles and documents
LED PHOTOINITIATORS
-
Paragraph 0159; 0160; 0161; 0162; 0163; 0164; 0165, (2017/04/11)
Amine derivatives of benzoylbenzoic acid, benzoylbenzoic acid esters and salts were prepared, which are suitable as photo initiators for UV and LED curable compositions. The derivatives are compounds of Formula I, Ia, and II wherein R1, R1