289039-85-6 Usage
Uses
Used in Pharmaceutical Industry:
METHYL 3-CHLORO-5-IODOBENZOATE is used as a chemical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and the production of existing ones.
Used in Agrochemical Production:
METHYL 3-CHLORO-5-IODOBENZOATE is utilized as a key component in the production of agrochemicals, playing a significant role in the development of products that protect and enhance crop yields.
Used in Dye and Pigment Industries:
METHYL 3-CHLORO-5-IODOBENZOATE is used as a precursor in the creation of dyes and pigments, contributing to the coloration and quality of various products in these industries.
Used in Research and Development:
In the realm of scientific research, METHYL 3-CHLORO-5-IODOBENZOATE is employed for the exploration and development of new chemical entities, potentially leading to breakthroughs in various fields.
It is essential to handle METHYL 3-CHLORO-5-IODOBENZOATE with care and follow proper safety protocols due to its potential hazards, ensuring the safety of both individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 289039-85-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,9,0,3 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 289039-85:
(8*2)+(7*8)+(6*9)+(5*0)+(4*3)+(3*9)+(2*8)+(1*5)=186
186 % 10 = 6
So 289039-85-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClIO2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3