292636-08-9 Usage
Uses
Used in Organic Synthesis:
7-Bromo-5-chloroindole is utilized as a building block in organic synthesis for the creation of complex organic molecules. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of a wide range of compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 7-Bromo-5-chloroindole is used as a key intermediate in the development of new drugs. Its presence in various drug molecules can influence their pharmacological properties, such as potency, selectivity, and bioavailability.
Used in Medicinal Chemistry:
7-Bromo-5-chloroindole plays a significant role in medicinal chemistry, where it is employed to explore and understand the structure-activity relationships of drug candidates. Its ability to be modified and incorporated into various chemical entities makes it a promising candidate for the design of novel therapeutic agents.
Used in the Synthesis of Novel Materials:
7-Bromo-5-chloroindole is also used in the synthesis of new materials with specialized properties. Its unique chemical structure can contribute to the development of materials with specific characteristics, such as improved stability, reactivity, or selectivity, which can be applied in various industries, including electronics, materials science, and environmental technology.
Check Digit Verification of cas no
The CAS Registry Mumber 292636-08-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,2,6,3 and 6 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 292636-08:
(8*2)+(7*9)+(6*2)+(5*6)+(4*3)+(3*6)+(2*0)+(1*8)=159
159 % 10 = 9
So 292636-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H5BrClN/c9-7-4-6(10)3-5-1-2-11-8(5)7/h1-4,11H
