38521-46-9 Usage
Uses
Used in Chemical Synthesis:
2-Mercaptonicotinic acid is used as a key intermediate in the synthesis of various organic compounds and coordination complexes. Its presence of both thiol and carboxylic acid functional groups makes it a versatile building block for the development of new materials and pharmaceuticals.
Used in Coordination Chemistry:
In coordination chemistry, 2-Mercaptonicotinic acid is used as a ligand to form coordination complexes with metal ions. It can chelate metal ions through its thiol and carboxylic acid groups, leading to the formation of stable complexes with potential applications in catalysis, sensing, and medicinal chemistry.
Used in the Synthesis of Poly[[diaquabis([μ]2-4,4′-bipyridyl)iron(II)] bis2-[(3-carboxypyridin-2-yl)disulfanyl]nicotinate]:
2-Mercaptonicotinic acid is used as a starting material for the synthesis of poly[[diaquabis([μ]2-4,4′-bipyridyl)iron(II)] bis2-[(3-carboxypyridin-2-yl)disulfanyl]nicotinate], a coordination polymer with potential applications in various fields, such as catalysis, drug delivery, and materials science.
Used in the Synthesis of 2-(2-carboxyethylthio)nicotinic acid:
2-Mercaptonicotinic acid is also used in the synthesis of 2-(2-carboxyethylthio)nicotinic acid, a compound with potential applications in pharmaceuticals and other industries. The thiol group of 2-Mercaptonicotinic acid can be alkylated to form the desired 2-(2-carboxyethylthio)nicotinic acid, which can then be used for further chemical transformations or as a final product.
Check Digit Verification of cas no
The CAS Registry Mumber 38521-46-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,5,2 and 1 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 38521-46:
(7*3)+(6*8)+(5*5)+(4*2)+(3*1)+(2*4)+(1*6)=119
119 % 10 = 9
So 38521-46-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H5NO2S/c8-6(9)4-2-1-3-7-5(4)10/h1-3,8-9H/p-2
