4230-08-4 Usage
Functional groups
Carboxylic acid (-COOH), thiol (-SH)
Structure
Long-chain carboxylic acid with a sulfur atom attached to the eleventh carbon
Applications
a. Synthesis of self-assembled monolayers
b. Biosensors
c. Nanotechnology
Surface properties
Exhibits interesting surface properties due to its unique structure
Uses
a. Surface modification
b. Functionalization
Potential applications
a. Corrosion inhibitor
b. Surfactant in industrial processes
Versatility
Wide range of potential uses in various fields due to its chemical properties and applications
Check Digit Verification of cas no
The CAS Registry Mumber 4230-08-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,2,3 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 4230-08:
(6*4)+(5*2)+(4*3)+(3*0)+(2*0)+(1*8)=54
54 % 10 = 4
So 4230-08-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H36O2S/c1-2-3-4-10-13-16-21-17-14-11-8-6-5-7-9-12-15-18(19)20/h2-17H2,1H3,(H,19,20)