5455-16-3 Usage
Molecular structure
A long hydrocarbon chain with a sulfur atom attached at the 11th carbon.
Functional group
Carboxyl group (-COOH) at one end of the chain.
Classification
Carboxylic acid.
Subclass
Sulfanylalkanoic acids.
Industrial applications
Can be used in various industrial processes and chemical reactions.
Unique properties
The presence of a sulfur atom in the structure contributes to its unique chemical properties.
Safety precautions
Handle with care and follow safety guidelines due to potential hazards associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 5455-16-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5455-16:
(6*5)+(5*4)+(4*5)+(3*5)+(2*1)+(1*6)=93
93 % 10 = 3
So 5455-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H28O2S/c1-2-12-17-13-10-8-6-4-3-5-7-9-11-14(15)16/h2-13H2,1H3,(H,15,16)
