68399-12-2 Usage
General Description
The chemical compound "(2E,5E)-7-[(1R)-2β-[(E,R)-4-(3-Chlorophenoxy)-3-hydroxy-1-butenyl]-3α,5α-dihydroxycyclopentan-1α-yl]-2,5-heptadienoic acid methyl ester" is a methyl ester derivative of a complex organic acid molecule. It contains a cyclopentane ring with hydroxyl groups and a chlorophenyl side chain. The compound also has several conjugated double bonds and a carboxylic acid functional group. This chemical structure suggests potential reactivity and biological activity, making it of interest in pharmaceutical and medicinal chemistry research. Additionally, the compound's stereochemistry and multiple chiral centers add to its complexity and potential usefulness as a synthetic target for chemical synthesis and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 68399-12-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,3,9 and 9 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 68399-12:
(7*6)+(6*8)+(5*3)+(4*9)+(3*9)+(2*1)+(1*2)=172
172 % 10 = 2
So 68399-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H29ClO6/c1-29-23(28)10-5-3-2-4-9-19-20(22(27)14-21(19)26)12-11-17(25)15-30-18-8-6-7-16(24)13-18/h2,4-8,10-13,17,19-22,25-27H,3,9,14-15H2,1H3/b4-2+,10-5+,12-11+/t17-,19?,20-,21?,22?/m1/s1
68399-12-2Relevant articles and documents
Prostaglandin Analogues Possessing Antinidatory Effects. 2. Modification of the α Chain
Hayashi, Masaki,Arai, Yoshinobu,Wakatsuka, Hirohisa,Kawamura, Masanori,Konishi, Yoshitaka,et al.
, p. 525 - 535 (2007/10/02)
Additional double bonds were introduced into the α chain in 16-phenoxy-, 16-(3-chlorophenoxy)-, 16--, and 16-(4-chlorophenoxy)-17,18,19,20-tetranorprostaglandins which have antinidatory effects.Of these analogues, the Δ3/