74758-93-3 Usage
Uses
Used in Flavor and Fragrance Industry:
Methylthiomethyl butyrate is used as a flavoring agent for its metallic fruity odor and sulfurous, savory, fruity, and tropical taste with vegetative and onion nuances. It can be used to enhance the flavor of various food products and beverages.
Used in Perfumery:
Methylthiomethyl butyrate is used as a fragrance ingredient in perfumery due to its metallic fruity odor. It can be used to create unique and complex scents in perfumes and other fragrance products.
Used in Chemical Synthesis:
Methylthiomethyl butyrate can be used as a chemical intermediate in the synthesis of other organic compounds, such as pharmaceuticals, agrochemicals, and specialty chemicals. Its unique sulfur-containing structure makes it a valuable building block for the development of new molecules with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 74758-93-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,7,5 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 74758-93:
(7*7)+(6*4)+(5*7)+(4*5)+(3*8)+(2*9)+(1*3)=173
173 % 10 = 3
So 74758-93-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H12O2S/c1-3-4-6(7)8-5-9-2/h3-5H2,1-2H3
