767-62-4 Usage
General Description
[1,2,4]triazolo[4,3-a]pyridin-3-amine is a chemical compound with a complex molecular structure, containing a triazolo ring fused with a pyridine ring. It is a heterocyclic compound that has potential applications in the field of medicinal chemistry and drug discovery. The compound is of interest due to its ability to interact with biological targets and has been studied for its potential pharmacological properties. It is also used as a building block in the synthesis of various organic compounds and can serve as a scaffold for the development of novel drug candidates. The specific properties and potential uses of [1,2,4]triazolo[4,3-a]pyridin-3-amine are areas of ongoing research and discovery in the field of chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 767-62-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,6 and 7 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 767-62:
(5*7)+(4*6)+(3*7)+(2*6)+(1*2)=94
94 % 10 = 4
So 767-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-6-9-8-5-3-1-2-4-10(5)6/h1-4H,(H2,7,9)
767-62-4Relevant articles and documents
Α 7 as intranuclear hydroxynicotinic acetylcholine receptor quinuclidines compd.
-
Paragraph 0507; 0509, (2018/10/03)
PROBLEM TO BE SOLVED: To provide ligands for the nicotinic α-7 receptor used for the treatment of various disorders of the central nervous system, especially affective and neurodegenerative disorders.SOLUTION: The disclosure provides compounds of the specified formula I, including their salts, and compositions and methods using the compounds.
