77474-33-0 Usage
Description
7-Methoxy-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid is a complex chemical compound belonging to the quinoline carboxylic acid class. It features a quinoline ring system with a carboxylic acid group, along with a methoxy and oxo functional group, which confer unique reactivity and potential biological activities. Known for its pharmacological and therapeutic properties, this compound is a significant entity in medicinal chemistry research.
Uses
Used in Pharmaceutical Industry:
7-Methoxy-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid is used as a precursor in the synthesis of various pharmaceuticals for its potential antimicrobial, anti-inflammatory, and disease-treating properties. Its unique molecular structure allows it to interact with biological targets, making it a promising candidate for developing new drugs.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 7-Methoxy-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid is utilized as a key compound for studying its potential as an antimicrobial agent, anti-inflammatory drug, and in the treatment of various diseases. Its chemical moieties provide a foundation for exploring novel therapeutic approaches and understanding its mechanisms of action.
Used in Drug Development:
7-Methoxy-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid is employed in drug development as a lead compound for creating new pharmaceutical entities. Its unique reactivity and biological activities are harnessed to design and optimize drugs with improved efficacy and safety profiles for treating a range of medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 77474-33-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,4,7 and 4 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 77474-33:
(7*7)+(6*7)+(5*4)+(4*7)+(3*4)+(2*3)+(1*3)=160
160 % 10 = 0
So 77474-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO4/c1-16-6-2-3-7-8(4-6)12-9(11(14)15)5-10(7)13/h2-5H,1H3,(H,12,13)(H,14,15)
77474-33-0Relevant articles and documents
Antagonists of melanin concentrating hormone effects on the melanin concentrating hormone receptor
-
Page/Page column 31, (2010/02/14)
The present invention is directed to compounds of formula (I), which antagonize of the effects of melanin-concentrating hormone (MCH) through the melanin concentrating hormone receptor which is useful for the prevention or treatment of eating disorders, weight gain, obesity, abnormalities in reproduction and sexual behavior, thyroid hormone secretion, diuresis and water/electrolyte homeostasis, sensory processing, memory, sleeping, arousal, anxiety, depression, seizures, neurodegeneration and psychiatric disorders.
