78497-53-7 Usage
Description
2,4(1H,3H)-Pyrimidinedione, 5-methyl-1-(4-((7-oxo-7H-furo(3,2-g)(1)benzopyran-9-yl)oxy)butyl)is a complex organic compound characterized by a pyrimidinedione core structure with a methyl substituent at position 5. It features a butyl group linked to a benzopyran-9-yl moiety, which is part of a fused furan and benzene ring system. The presence of a keto group in its structure indicates potential pharmacological properties and biological activities, making it a promising candidate for further research in medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Industry:
2,4(1H,3H)-Pyrimidinedione, 5-methyl-1-(4-((7-oxo-7H-furo(3,2-g)(1)benzopyran-9-yl)oxy)butyl)is used as a potential pharmaceutical compound for its potential pharmacological properties and biological activities. Its unique chemical structure suggests that it may have applications in the development of new drugs, particularly in the areas of medicinal chemistry and drug discovery.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2,4(1H,3H)-Pyrimidinedione, 5-methyl-1-(4-((7-oxo-7H-furo(3,2-g)(1)benzopyran-9-yl)oxy)butyl)is used as a subject of study for its potential to contribute to the understanding of molecular interactions and the development of novel therapeutic agents. Its complex structure and the presence of a keto group may offer insights into the design of new drugs with improved efficacy and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 78497-53-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,4,9 and 7 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 78497-53:
(7*7)+(6*8)+(5*4)+(4*9)+(3*7)+(2*5)+(1*3)=187
187 % 10 = 7
So 78497-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C20H18N2O6/c1-12-11-22(20(25)21-19(12)24)7-2-3-8-26-18-16-14(6-9-27-16)10-13-4-5-15(23)28-17(13)18/h4-6,9-11H,2-3,7-8H2,1H3,(H,21,24,25)