81972-27-2 Usage
Uses
Used in Synthetic Chemistry:
3-(Trichlorovinyl)anilinium chloride is used as a synthetic intermediate for the production of various chemical compounds and materials. Its unique structure allows it to participate in a range of chemical reactions, facilitating the synthesis of complex organic molecules and contributing to the development of new pharmaceuticals, agrochemicals, and specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-(Trichlorovinyl)anilinium chloride is used as a building block for the synthesis of active pharmaceutical ingredients. Its reactivity and functional groups make it a valuable component in the creation of new drugs with specific therapeutic properties, potentially leading to advancements in the treatment of various diseases and medical conditions.
Used in Agrochemical Industry:
3-(Trichlorovinyl)anilinium chloride is utilized as a key component in the development of agrochemicals, such as pesticides and herbicides. Its chemical properties enable it to be incorporated into formulations that effectively control, prevent, or kill unwanted organisms in agricultural settings, thereby contributing to increased crop yields and protection against pests.
Used in Specialty Chemicals Production:
3-(Trichlorovinyl)anilinium chloride is employed as a precursor in the production of specialty chemicals, which are high-value compounds used in niche applications. These may include dyes, pigments, polymers, and other materials that require specific chemical and physical properties, such as resistance to heat, light, or chemicals, making them suitable for use in various industries like textiles, plastics, and coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 81972-27-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,9,7 and 2 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 81972-27:
(7*8)+(6*1)+(5*9)+(4*7)+(3*2)+(2*2)+(1*7)=152
152 % 10 = 2
So 81972-27-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H6Cl3N.ClH/c9-7(8(10)11)5-2-1-3-6(12)4-5;/h1-4H,12H2;1H
81972-27-2Relevant articles and documents
Hydrogenation of 3-trichlorovinylnitrobenzene
-
, (2008/06/13)
There is disclosed a process for the conversion of 3-trichlorovinylnitrobenzene to 3-trichlorovinylaniline by catalytic reduction in an alcoholic acidic medium, using a supported palladium catalyst in a hydrogen atmosphere. The process is carried out with
