84639-84-9 Usage
General Description
7-HYDROXY-1H-INDOLE-2-CARBOXYLIC ACID is a chemical compound with the molecular formula C9H7NO3. It is a derivative of indole, a heterocyclic compound commonly found in nature. 7-HYDROXY-1H-INDOLE-2-CARBOXYLIC ACID has a hydroxyl group and a carboxylic acid group attached to the indole ring, making it a carboxylic acid derivative. 7-HYDROXY-1H-INDOLE-2-CARBOXYLIC ACID has been studied for its potential pharmaceutical applications, particularly in the field of anti-inflammatory and anti-oxidant properties. Its chemical structure and reactivity make it a promising candidate for the development of new drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 84639-84-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,6,3 and 9 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 84639-84:
(7*8)+(6*4)+(5*6)+(4*3)+(3*9)+(2*8)+(1*4)=169
169 % 10 = 9
So 84639-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO3/c11-7-3-1-2-5-4-6(9(12)13)10-8(5)7/h1-4,10-11H,(H,12,13)
