84771-20-0 Usage
Uses
Used in Pharmaceutical Industry:
FMOC-TRP-OSU is used as a building block for the synthesis of peptides and peptide fragments, which are essential components of various pharmaceutical products. Its protected structure ensures the efficient and accurate assembly of peptide sequences during the synthesis process.
Used in Research and Development:
In the field of research and development, FMOC-TRP-OSU is utilized for the synthesis of novel peptide-based compounds with potential therapeutic applications. Its use in solid-phase synthesis allows for the rapid and efficient production of these compounds, facilitating the discovery of new drugs and therapeutic agents.
Used in Diagnostic Applications:
FMOC-TRP-OSU is also employed in the development of diagnostic tools, such as radiolabeled peptides for imaging studies. The incorporation of radioisotopes, like carbon-13, into the peptide structure allows for the tracking and visualization of biological processes in vivo.
Check Digit Verification of cas no
The CAS Registry Mumber 84771-20-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,7,7 and 1 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 84771-20:
(7*8)+(6*4)+(5*7)+(4*7)+(3*1)+(2*2)+(1*0)=150
150 % 10 = 0
So 84771-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C30H25N3O6/c34-27-13-14-28(35)33(27)39-29(36)26(15-18-16-31-25-12-6-5-7-19(18)25)32-30(37)38-17-24-22-10-3-1-8-20(22)21-9-2-4-11-23(21)24/h1-12,16,24,26,31H,13-15,17H2,(H,32,37)