95233-12-8 Usage
Description
4-Methoxycyclohexanecarboxylic acid is an organic compound that serves as a reagent in the synthesis of various chemical compounds. It is known for its ability to react with different reagents to form new compounds, making it a valuable component in chemical research and development.
Uses
Used in Pharmaceutical Research:
4-Methoxycyclohexanecarboxylic acid is used as a reagent in the discovery of a series of highly brain penetrant, selective muscarinic M1 agonists. These agonists have potential applications in the treatment of neurological disorders and cognitive enhancement.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-Methoxycyclohexanecarboxylic acid is used as a starting material to produce various chemical compounds. For example, its reaction with methyllithium results in the formation of ketone, cis-4-methoxy-1-acetylcyclohexane. Additionally, its reaction with acetic acid and a catalytic amount of sulfuric acid has been investigated for further chemical transformations.
Used in Organic Chemistry:
4-Methoxycyclohexanecarboxylic acid is utilized in organic chemistry as a versatile building block for the synthesis of complex organic molecules. Its unique structure allows for various chemical reactions, making it a valuable asset in the development of new compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 95233-12-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,2,3 and 3 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 95233-12:
(7*9)+(6*5)+(5*2)+(4*3)+(3*3)+(2*1)+(1*2)=128
128 % 10 = 8
So 95233-12-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O3/c1-11-7-4-2-6(3-5-7)8(9)10/h6-7H,2-5H2,1H3,(H,9,10)
95233-12-8Relevant articles and documents
(8β)-6-Methylergoline amide derivatives as serotonin antagonists: N1-substituent effects on vascular 5HT2 receptor activity
Misner,Garbrecht,Marzoni,Whitten,Cohen
, p. 652 - 656 (2007/10/02)
A series of (8β)-6-methylergoline amide derivatives was synthesized with various alkyl substituents in the N1-position in order to evaluate their effectiveness in blocking vascular 5HT2 receptors. The influence of both the N1 substituent and amide derivative proved to be of great importance on binding affinities to vascular 5HT2 receptors. Within each series of amides, however, maximum affinity was achieved with an N1-isopropyl substituent (14, 18, 26, 38, and 41; all with 2.7-5.0 times greater affinity than their N1-H analogues), with the exception of two cases (22 and 37) in the cyclohexylamide derivatives wherein N1-methyl equalled the isopropyl in potency. Other than these exceptions, affinities followed the pattern of H Me Et iPr, with potencies falling off with larger alkyl substituents.