99184-85-7 Usage
Description
(1,3-Benzothiazol-2-ylmethyl)thio]acetic acid is a complex thio compound characterized by the presence of a sulfur atom and a benzothiazole ring in its molecular structure. It belongs to the class of thio compounds and has potential applications in various fields, including organic synthesis, pharmaceuticals, and material science. The benzothiazole ring, a heterocyclic compound with potential biological activity, and the thio group in the molecule give it unique properties and potential for functionalization. Overall, (1,3-Benzothiazol-2-ylmethyl)thio]acetic acid is a versatile compound with potential applications in various industries.
Used in Organic Synthesis:
(1,3-Benzothiazol-2-ylmethyl)thio]acetic acid is used as a building block in organic synthesis for the creation of various chemical compounds. Its unique molecular structure allows for functionalization and the formation of new compounds with different properties and applications.
Used in Pharmaceutical Industry:
(1,3-Benzothiazol-2-ylmethyl)thio]acetic acid is used as an active pharmaceutical ingredient or as an intermediate in the synthesis of drugs. Its potential biological activity and unique molecular structure make it a promising candidate for the development of new medications.
Used in Material Science:
(1,3-Benzothiazol-2-ylmethyl)thio]acetic acid is used in the development of new materials with specific properties. Its unique molecular structure and potential for functionalization allow for the creation of materials with tailored characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 99184-85-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,1,8 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 99184-85:
(7*9)+(6*9)+(5*1)+(4*8)+(3*4)+(2*8)+(1*5)=187
187 % 10 = 7
So 99184-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO2S2/c12-10(13)6-14-5-9-11-7-3-1-2-4-8(7)15-9/h1-4H,5-6H2,(H,12,13)
99184-85-7Relevant articles and documents
Synthesis of some new oxazolinyl/thia-zolinyl/imidazolinyl-benzoxazoles, benzothiazoles and benzimidazoles
Seenaiah,Venkatesh,Padmaja,Padmavathi
, p. 942 - 948 (2013/08/15)
A new class of oxazolinyl/thiazolinyl/imidazolinyl-benzo- xazoles/benzothiazoles/benzimidazoles have been prepared by exploiting the respective heterocyclic sulfonyl acetic acid methyl ester functionality with different nucleophiles using samarium(III) chloride.
