99513-52-7 Usage
General Description
Acetic acid, (2-benzothiazolylmethoxy)- is a chemical compound with the molecular formula C10H9NO3S. It is a derivative of acetic acid that contains a benzothiazole group. Acetic acid, (2-benzothiazolylmethoxy)- (6CI) is commonly used as a stabilizer and preservative in various industrial and commercial applications. It has antimicrobial properties, making it useful as an agent in the production of certain products, including pharmaceuticals, plastics, and coatings. Additionally, it can be used as an intermediate in the synthesis of other organic compounds and chemicals. Despite its usefulness in various industries, the compound should be handled with caution due to its potential hazardous effects on health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 99513-52-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,5,1 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 99513-52:
(7*9)+(6*9)+(5*5)+(4*1)+(3*3)+(2*5)+(1*2)=167
167 % 10 = 7
So 99513-52-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO3S/c12-10(13)6-14-5-9-11-7-3-1-2-4-8(7)15-9/h1-4H,5-6H2,(H,12,13)
